Difference between revisions of "Tiso gene 13684"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7860 CPD-7860] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3781 PWY-3781] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7860 CPD-7860] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3781 PWY-3781] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=DFNMSBYEEKBETA-GVVOHZSFSA-N
+
 
* common name:
 
* common name:
−
** 3-hydroxyechinenone
+
** aerobic respiration I (cytochrome c)
−
* molecular weight:
+
−
** 566.865   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-4-keto-β,β-carotene
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''4''' reaction(s) found
−
* [[R07562]]
+
** [[1.10.2.2-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** [[NADH-DEHYDROG-A-RXN]]
 +
** [[CYTOCHROME-C-OXIDASE-RXN]]
 +
** [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 +
== Reaction(s) not found ==
 +
* '''0''' reaction(s) not found
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10120578 10120578]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3781 PWY-3781]
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://www.chemspider.com/Chemical-Structure.8296099.html 8296099]
+
{{#set: taxonomic range=TAX-2759}}
−
* LIGAND-CPD:
+
{{#set: common name=aerobic respiration I (cytochrome c)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15966 C15966]
+
{{#set: reaction found=4}}
−
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(C(CC(C(C=1C)=O)O)(C)C))C)C)C=CC=C(C)C=CC2(=C(CCCC2(C)C)C)}}
+
{{#set: reaction not found=0}}
−
{{#set: inchi key=InChIKey=DFNMSBYEEKBETA-GVVOHZSFSA-N}}
+
−
{{#set: common name=3-hydroxyechinenone}}
+
−
{{#set: molecular weight=566.865    }}
+
−
{{#set: common name=3-hydroxy-4-keto-β,β-carotene}}
+
−
{{#set: produced by=R07562}}
+

Revision as of 16:42, 10 January 2018

Pathway PWY-3781

  • taxonomic range:
  • common name:
    • aerobic respiration I (cytochrome c)
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

  • 0 reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13684&oldid=14225"