Difference between revisions of "Tiso gene 16690"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glucur-Glucuronoside-Acceptors Non-Glucur-Glucuronoside-Acceptors] == * common name: ** a n...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glucur-Glucuronoside-Acceptors Non-Glucur-Glucuronoside-Acceptors] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] ==
 +
* smiles:
 +
** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
 +
* inchi key:
 +
** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
 
* common name:
 
* common name:
** a non-glucuronated glucosyluronate acceptor
+
** dihydrogeranylgeranyl diphosphate
 +
* molecular weight:
 +
** 449.44   
 
* Synonym(s):
 
* Synonym(s):
 +
** dihydroGGPP
 +
** dihydrogeranylgeranyl-PP
 +
** dihydrogeranylgeranyl pyrophosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-7659]]
 +
* [[RXN-7658]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a non-glucuronated glucosyluronate acceptor}}
+
* PUBCHEM:
{{#set: consumed by=UDP-GLUCURONOSYLTRANSFERASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526]
 +
{{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
 +
{{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}}
 +
{{#set: common name=dihydrogeranylgeranyl diphosphate}}
 +
{{#set: molecular weight=449.44    }}
 +
{{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}}
 +
{{#set: consumed or produced by=RXN-7659|RXN-7658}}

Revision as of 17:43, 10 January 2018

Metabolite CPD-7002

  • smiles:
    • CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
  • inchi key:
    • InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
  • common name:
    • dihydrogeranylgeranyl diphosphate
  • molecular weight:
    • 449.44
  • Synonym(s):
    • dihydroGGPP
    • dihydrogeranylgeranyl-PP
    • dihydrogeranylgeranyl pyrophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.