Difference between revisions of "ExchangeSeed FE+3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] == * smiles: ** CC(OCC([N+])C(=O)[O-])=O * inchi key: ** InChIKey=VZ...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-glucosides Beta-D-glucosides] == * common name: ** a β-D glucoside * Synonym(s): =...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLSERINE ACETYLSERINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-glucosides Beta-D-glucosides] ==
* smiles:
+
** CC(OCC([N+])C(=O)[O-])=O
+
* inchi key:
+
** InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N
+
 
* common name:
 
* common name:
** O-acetyl-L-serine
+
** a β-D glucoside
* molecular weight:
+
** 147.13   
+
 
* Synonym(s):
 
* Synonym(s):
** O3-acetyl-L-serine
 
** acetylserine
 
** O-acetylserine
 
** (2S)-3-acetyloxy-2-aminopropanoate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12726]]
+
* [[3.2.1.21-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SERINE-O-ACETTRAN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[ACSERLY-RXN]]
 
* [[SULFOCYS-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 66638-22-0
+
{{#set: common name=a β-D glucoside}}
* METABOLIGHTS : MTBLC17981
+
{{#set: consumed by=3.2.1.21-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971051 6971051]
+
* HMDB : HMDB03011
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00979 C00979]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58340 58340]
+
* BIGG : acser
+
{{#set: smiles=CC(OCC([N+])C(=O)[O-])=O}}
+
{{#set: inchi key=InChIKey=VZXPDPZARILFQX-BYPYZUCNSA-N}}
+
{{#set: common name=O-acetyl-L-serine}}
+
{{#set: molecular weight=147.13    }}
+
{{#set: common name=O3-acetyl-L-serine|acetylserine|O-acetylserine|(2S)-3-acetyloxy-2-aminopropanoate}}
+
{{#set: consumed by=RXN-12726}}
+
{{#set: produced by=SERINE-O-ACETTRAN-RXN}}
+
{{#set: consumed or produced by=ACSERLY-RXN|SULFOCYS-RXN}}
+

Revision as of 16:44, 10 January 2018

Metabolite Beta-D-glucosides

  • common name:
    • a β-D glucoside
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links