Difference between revisions of "Galactosylceramide-sulfate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] == * smiles: ** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=L...")
 
(Created page with "Category:Gene == Gene Tiso_gene_1602 == * left end position: ** 21 * transcription direction: ** POSITIVE * right end position: ** 5271 * centisome position: ** 9.11972900...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] ==
+
== Gene Tiso_gene_1602 ==
−
* smiles:
+
* left end position:
−
** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
+
** 21
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-(6'-methylthio)hexylmalate
+
** 5271
−
* molecular weight:
+
* centisome position:
−
** 262.32   
+
** 9.11972900e-2
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(6'-methylthio)hexylmalic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXNQT-4174]]
+
* [[HOMOCYSMET-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** experimental_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
−
* [[RXN-18202]]
+
* [[HOMOCYSMETB12-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[R00946]]
 +
** [[pantograph]]-[[synechocystis]]
 +
== Pathways associated ==
 +
* [[PWY-3841]]
 +
* [[ADENOSYLHOMOCYSCAT-PWY]]
 +
* [[PWY-702]]
 +
* [[HOMOSER-METSYN-PWY]]
 +
* [[HSERMETANA-PWY]]
 +
* [[PWY-5041]]
 +
* [[PWY-2201]]
 +
* [[1CMET2-PWY]]
 +
* [[PWY-6151]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=21}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237339 44237339]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
+
{{#set: right end position=5271}}
−
{{#set: inchi key=InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L}}
+
{{#set: centisome position=9.11972900e-2}}
−
{{#set: common name=3-(6'-methylthio)hexylmalate}}
+
{{#set: reaction associated=HOMOCYSMET-RXN|HOMOCYSMETB12-RXN|R00946}}
−
{{#set: molecular weight=262.32    }}
+
{{#set: pathway associated=PWY-3841|ADENOSYLHOMOCYSCAT-PWY|PWY-702|HOMOSER-METSYN-PWY|HSERMETANA-PWY|PWY-5041|PWY-2201|1CMET2-PWY|PWY-6151}}
−
{{#set: common name=3-(6'-methylthio)hexylmalic acid}}
+
−
{{#set: consumed by=RXNQT-4174}}
+
−
{{#set: consumed or produced by=RXN-18202}}
+

Revision as of 16:45, 10 January 2018

Gene Tiso_gene_1602

  • left end position:
    • 21
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5271
  • centisome position:
    • 9.11972900e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Galactosylceramide-sulfate&oldid=14457"