Difference between revisions of "Tiso gene 14466"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_546 == * left end position: ** 18304 * transcription direction: ** POSITIVE * right end position: ** 31799 * centisome position: ** 57.3757...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * smiles: ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J |
− | * | + | * common name: |
− | ** | + | ** 3-oxo-(9Z)-hexadecenoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 1013.883 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-oxo-16:1-Δ9-CoA | ||
+ | ** 3-oxo-9-cis-hexadecenoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-17791]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17790]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}} |
− | {{#set: | + | {{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}} |
− | {{#set: | + | {{#set: molecular weight=1013.883 }} |
− | {{#set: | + | {{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-17791}} |
+ | {{#set: produced by=RXN-17790}} |
Revision as of 17:45, 10 January 2018
Contents
Metabolite CPD-19158
- smiles:
- CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
- common name:
- 3-oxo-(9Z)-hexadecenoyl-CoA
- molecular weight:
- 1013.883
- Synonym(s):
- 3-oxo-16:1-Δ9-CoA
- 3-oxo-9-cis-hexadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.