Difference between revisions of "Tiso gene 13522"

Revision as of 16:45, 10 January 2018

"CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_12627 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-39 CPDQT-39] ==
+* smiles:
+** CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
+* inchi key:
+** InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L
+* common name:
+** 3-(6'-methylthio)hexylmalate
+* molecular weight:
+** 262.32
 * Synonym(s):
+** 3-(6'-methylthio)hexylmalic acid
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+* [[RXNQT-4174]]
-** [[pantograph]]-[[esiliculosus]]
+== Reaction(s) known to produce the compound ==
-== Pathways associated ==
+== Reaction(s) of unknown directionality ==
-* [[PWY-7511]]
+* [[RXN-18202]]
 == External links  ==
-{{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}}
+* PUBCHEM:
-{{#set: pathway associated=PWY-7511}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237339 44237339]
+{{#set: smiles=CSCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
+{{#set: inchi key=InChIKey=LQQZHLHCFSCJCU-UHFFFAOYSA-L}}
+{{#set: common name=3-(6'-methylthio)hexylmalate}}
+{{#set: molecular weight=262.32    }}
+{{#set: common name=3-(6'-methylthio)hexylmalic acid}}
+{{#set: consumed by=RXNQT-4174}}
+{{#set: consumed or produced by=RXN-18202}}