Difference between revisions of "CPD-7524"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
(Created page with "Category:Gene == Gene Tiso_gene_12946 == * Synonym(s): == Reactions associated == * 3.5.1.98-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12946 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[3.5.1.98-RXN]] | |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | * [[RXN- | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.5.1.98-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 17:46, 10 January 2018
Gene Tiso_gene_12946
- Synonym(s):