Difference between revisions of "LIPID-IV-A"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8892 CPD-8892] == * smiles: ** CCCCCC=CCC=CC=CC=C[CH]1(O[CH]1CCCC(=O)[O-]) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_8 == * Synonym(s): == Reactions associated == * RXN-5961 ** pantograph-creinhardtii * RXN-5962 ** pantograph-creinha...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-5961]] |
− | + | ** [[pantograph]]-[[creinhardtii]] | |
− | == | + | * [[RXN-5962]] |
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[UNSPECIFIC-MONOOXYGENASE-RXN]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5947]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-5961|RXN-5962|UNSPECIFIC-MONOOXYGENASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5947}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 17:46, 10 January 2018
Gene Tiso_gene_8
- Synonym(s):