Difference between revisions of "RXN0-1342"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == * smiles: ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14003 RXN-14003] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14003 RXN-14003] ==
−
* smiles:
+
* direction:
−
** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
+
** [http://enzyme.expasy.org/EC/3.6.1.64 EC-3.6.1.64]
−
* common name:
+
−
** (25R)-3α,7α-dihydroxy-5-β-cholestanate
+
−
* molecular weight:
+
−
** 433.65   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-α,7-α-dihydroxy-5-β-cholestanoate
 
−
** 3-α,7-α-dihydroxy-5-β-cholestanate
 
−
** (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-9844]]
+
** 1 [[WATER]][c] '''+''' 1 [[IDP]][c] '''=>''' 1 [[IMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 IDP[c] '''=>''' 1 IMP[c] '''+''' 1 H+[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_12899]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 +
*** [[athaliana]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266753 45266753]
+
{{#set: ec number=EC-3.6.1.64}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_12899}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58750 58750]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04554 C04554]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}}
+
{{#set: reconstruction source=creinhardtii|athaliana}}
−
{{#set: inchi key=InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M}}
+
−
{{#set: common name=(25R)-3α,7α-dihydroxy-5-β-cholestanate}}
+
−
{{#set: molecular weight=433.65    }}
+
−
{{#set: common name=3-α,7-α-dihydroxy-5-β-cholestanoate|3-α,7-α-dihydroxy-5-β-cholestanate|(25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate}}
+
−
{{#set: produced by=RXN-9844}}
+

Revision as of 17:47, 10 January 2018

Reaction RXN-14003

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 IDP[c] => 1 IMP[c] + 1 H+[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-1342&oldid=14612"