Difference between revisions of "Tiso gene 6882"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8862 == * Synonym(s): == Reactions associated == * LPLPS1AGPE180 ** pantograph-creinhardtii == Pathways associated == == Exter...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == * smiles: ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1834 CPD-1834] == |
+ | * smiles: | ||
+ | ** CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M | ||
+ | * common name: | ||
+ | ** (25R)-3α,7α-dihydroxy-5-β-cholestanate | ||
+ | * molecular weight: | ||
+ | ** 433.65 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-α,7-α-dihydroxy-5-β-cholestanoate | ||
+ | ** 3-α,7-α-dihydroxy-5-β-cholestanate | ||
+ | ** (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9844]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266753 45266753] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58750 58750] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04554 C04554] | ||
+ | {{#set: smiles=CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))}} | ||
+ | {{#set: inchi key=InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M}} | ||
+ | {{#set: common name=(25R)-3α,7α-dihydroxy-5-β-cholestanate}} | ||
+ | {{#set: molecular weight=433.65 }} | ||
+ | {{#set: common name=3-α,7-α-dihydroxy-5-β-cholestanoate|3-α,7-α-dihydroxy-5-β-cholestanate|(25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate}} | ||
+ | {{#set: produced by=RXN-9844}} |
Revision as of 17:47, 10 January 2018
Contents
Metabolite CPD-1834
- smiles:
- CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))
- inchi key:
- InChIKey=ITZYGDKGRKKBSN-RXDNHGQQSA-M
- common name:
- (25R)-3α,7α-dihydroxy-5-β-cholestanate
- molecular weight:
- 433.65
- Synonym(s):
- 3-α,7-α-dihydroxy-5-β-cholestanoate
- 3-α,7-α-dihydroxy-5-β-cholestanate
- (25R)-3α,7α-dihydroxy-5-β-cholestan-26-oate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(C)C([O-])=O)[CH]1(CC[CH]2(C(C)1CC[CH]3([CH]2C(O)C[CH]4(C(C)3CCC(O)C4))))" cannot be used as a page name in this wiki.