Difference between revisions of "Tiso gene 11659"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-cis-D9-hexadecenoyl-ACPs 3-oxo-cis-D9-hexadecenoyl-ACPs] == * common name: ** a 3-oxo-cis...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9956 CPD-9956] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** ubiquinol-8 |
| + | * molecular weight: | ||
| + | ** 729.137 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ubiquinol(8) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DHHB-METHYLTRANSFER-RXN]] |
| + | * [[NADHor_2m]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25074411 25074411] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: produced by= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61682 61682] |
| + | * BIGG : q8h2 | ||
| + | * HMDB : HMDB01060 | ||
| + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)}} | ||
| + | {{#set: inchi key=InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N}} | ||
| + | {{#set: common name=ubiquinol-8}} | ||
| + | {{#set: molecular weight=729.137 }} | ||
| + | {{#set: common name=ubiquinol(8)}} | ||
| + | {{#set: produced by=DHHB-METHYLTRANSFER-RXN|NADHor_2m}} | ||
Revision as of 16:48, 10 January 2018
Contents
Metabolite CPD-9956
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(O)=C(OC)C(OC)=C(O)C(C)=1)
- inchi key:
- InChIKey=LOJUQFSPYHMHEO-SGHXUWJISA-N
- common name:
- ubiquinol-8
- molecular weight:
- 729.137
- Synonym(s):
- ubiquinol(8)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
