Difference between revisions of "RXN-11501"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] == * smiles: ** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME297 RME297] == * direction: ** REVERSIBLE * common name: ** RME297 * Synonym(s): == Reaction Fo...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME297 RME297] ==
* smiles:
+
* direction:
** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K
+
 
* common name:
 
* common name:
** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate
+
** RME297
* molecular weight:
+
** 380.17   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-15733]]
+
** 1.0 [[NADH-P-OR-NOP]][c] '''<=>''' 1.0 [[NADH]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 NAD(P)H[c] '''<=>''' 1.0 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[manual]]:
 +
** [[primary_network]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657876 90657876]
+
{{#set: common name=RME297}}
{{#set: smiles=CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}}
+
{{#set: in pathway=}}
{{#set: inchi key=InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K}}
+
{{#set: reconstruction category=manual}}
{{#set: common name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate}}
+
{{#set: reconstruction source=primary_network}}
{{#set: molecular weight=380.17    }}
+
{{#set: produced by=RXN-15733}}
+

Revision as of 17:48, 10 January 2018

Reaction RME297

  • direction:
    • REVERSIBLE
  • common name:
    • RME297
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NAD(P)H[c] <=> 1.0 NADH[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links