Difference between revisions of "Tiso gene 12960"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_65 == * left end position: ** 41134 * transcription direction: ** POSITIVE * right end position: ** 42238 * centisome position: ** 78.07683...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] == * smiles: ** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1) * inc...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_65 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-4 CPD1F-4] ==
−
* left end position:
+
* smiles:
−
** 41134
+
** CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
−
* right end position:
+
* common name:
−
** 42238
+
** (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
−
* centisome position:
+
* molecular weight:
−
** 78.076836    
+
** 382.542    
 
* Synonym(s):
 
* Synonym(s):
 +
** C25-allenic-apo-aldehyde
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[F16ALDOLASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-698]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** experimental_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[FPGPL]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[RXN-8631]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** experimental_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[SEDOBISALDOL-RXN]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways associated ==
+
−
* [[PWY-1042]]
+
−
* [[P341-PWY]]
+
−
* [[PWY66-373]]
+
−
* [[GLUCONEO-PWY]]
+
−
* [[GLYCOLYSIS]]
+
−
* [[SUCSYN-PWY]]
+
−
* [[PWY-7385]]
+
−
* [[ANAGLYCOLYSIS-PWY]]
+
−
* [[CALVIN-PWY]]
+
−
* [[PWY0-1517]]
+
−
* [[PWY-1861]]
+
−
* [[PWY-6142]]
+
−
* [[PWY-5484]]
+
−
* [[P185-PWY]]
+
−
* [[PWY66-399]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=41134}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245424 25245424]
−
{{#set: right end position=42238}}
+
* CHEBI:
−
{{#set: centisome position=78.076836   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34596 34596]
−
{{#set: reaction associated=F16ALDOLASE-RXN|FPGPL|RXN-8631|SEDOBISALDOL-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-1042|P341-PWY|PWY66-373|GLUCONEO-PWY|GLYCOLYSIS|SUCSYN-PWY|PWY-7385|ANAGLYCOLYSIS-PWY|CALVIN-PWY|PWY0-1517|PWY-1861|PWY-6142|PWY-5484|P185-PWY|PWY66-399}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C14044 C14044]
 +
{{#set: smiles=CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)}}
 +
{{#set: inchi key=InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N}}
 +
{{#set: common name=(3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al}}
 +
{{#set: molecular weight=382.542   }}
 +
{{#set: common name=C25-allenic-apo-aldehyde}}
 +
{{#set: produced by=RXN-698}}

Revision as of 16:49, 10 January 2018

Metabolite CPD1F-4

  • smiles:
    • CC(=CC=CC=C(C)C=O)C=CC=C(C)C=C=C1(C(O)(C)CC(O)CC(C)(C)1)
  • inchi key:
    • InChIKey=MFDUGTOOXGORRX-ORGLZDQCSA-N
  • common name:
    • (3S,5R,6R)-3,5-dihydroxy-6,7-didehydro-5,6-dihydro-12'-apo-β-caroten-12'-al
  • molecular weight:
    • 382.542
  • Synonym(s):
    • C25-allenic-apo-aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12960&oldid=14813"