Difference between revisions of "CPD-7032"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_6679 == * left end position: ** 1527 * transcription direction: ** POSITIVE * right end position: ** 3307 * centisome position: ** 6.608959...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14925 CPD-14925] == * smiles: ** CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_6679 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14925 CPD-14925] ==
* left end position:
+
* smiles:
** 1527
+
** CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=CQGVNMQHZQJNII-UUSBZYPOSA-J
* right end position:
+
* common name:
** 3307
+
** 3-cis-decenoyl-CoA
* centisome position:
+
* molecular weight:
** 6.608959    
+
** 915.738    
 
* Synonym(s):
 
* Synonym(s):
 +
** (3Z)-dec-3-enoyl-CoA
 +
** 10:1(n-7)-CoA
 +
** 10:1-Δ3-CoA
 +
** (3Z)-decenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GLUTATHIONE-PEROXIDASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN-17799]]
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[DETOX1-PWY-1]]
+
* [[PWY-4081]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1527}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659267 90659267]
{{#set: right end position=3307}}
+
{{#set: smiles=CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
{{#set: centisome position=6.608959   }}
+
{{#set: inchi key=InChIKey=CQGVNMQHZQJNII-UUSBZYPOSA-J}}
{{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN}}
+
{{#set: common name=3-cis-decenoyl-CoA}}
{{#set: pathway associated=DETOX1-PWY-1|PWY-4081}}
+
{{#set: molecular weight=915.738   }}
 +
{{#set: common name=(3Z)-dec-3-enoyl-CoA|10:1(n-7)-CoA|10:1-Δ3-CoA|(3Z)-decenoyl-CoA}}
 +
{{#set: produced by=RXN-17799}}

Revision as of 16:50, 10 January 2018

Metabolite CPD-14925

  • smiles:
    • CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • inchi key:
    • InChIKey=CQGVNMQHZQJNII-UUSBZYPOSA-J
  • common name:
    • 3-cis-decenoyl-CoA
  • molecular weight:
    • 915.738
  • Synonym(s):
    • (3Z)-dec-3-enoyl-CoA
    • 10:1(n-7)-CoA
    • 10:1-Δ3-CoA
    • (3Z)-decenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.