Difference between revisions of "AMETt2h"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE DIHYDROFOLATE] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C3...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10039 RXN-10039] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE DIHYDROFOLATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10039 RXN-10039] ==
* smiles:
+
* direction:
** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=OZRNSSUDZOLUSN-LBPRGKRZSA-L
+
** [http://enzyme.expasy.org/EC/2.9.1.2 EC-2.9.1.2]
* common name:
+
** 7,8-dihydrofolate monoglutamate
+
* molecular weight:
+
** 441.402   
+
 
* Synonym(s):
 
* Synonym(s):
** 7,8-pteroylglutamic acid
 
** 7,8-pteroylglutamate
 
** 7,8-dihydropteroyl monoglutamate
 
** H2PteGlu
 
** H2PteGlu1
 
** dihydrofolate
 
** 7,8-dihydropteroylglutamate
 
** 7,8-dihydrofolate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[R00939]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[O-phospho-L-seryl-tRNASecs]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[SEPO3]][c] '''=>''' 1 [[Charged-SEC-tRNAs]][c] '''+''' 2 [[Pi]][c]
* [[DIHYDROFOLATESYNTH-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 an O-phospho-L-seryl-[tRNASec][c] '''+''' 1 H2O[c] '''+''' 1 selenophosphate[c] '''=>''' 1 an L-selenocysteinyl-[tRNAsec][c] '''+''' 2 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_16385]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6281]], L-selenocysteine biosynthesis II (archaea and eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6281 PWY-6281]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
* CAS : 4033-27-6
+
* LIGAND-RXN:
* METABOLIGHTS : MTBLC57451
+
** [http://www.genome.jp/dbget-bin/www_bget?R08224 R08224]
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40480038 40480038]
+
{{#set: ec number=EC-2.9.1.2}}
* HMDB : HMDB01056
+
{{#set: gene associated=Tiso_gene_16385}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6281}}
** [http://www.genome.jp/dbget-bin/www_bget?C00415 C00415]
+
{{#set: reconstruction category=orthology}}
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57451 57451]
+
{{#set: reconstruction source=esiliculosus}}
* BIGG : dhf
+
{{#set: reconstruction category=annotation}}
{{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=OZRNSSUDZOLUSN-LBPRGKRZSA-L}}
+
{{#set: reconstruction source=in-silico_annotation}}
{{#set: common name=7,8-dihydrofolate monoglutamate}}
+
{{#set: molecular weight=441.402    }}
+
{{#set: common name=7,8-pteroylglutamic acid|7,8-pteroylglutamate|7,8-dihydropteroyl monoglutamate|H2PteGlu|H2PteGlu1|dihydrofolate|7,8-dihydropteroylglutamate|7,8-dihydrofolate}}
+
{{#set: consumed by=R00939}}
+
{{#set: produced by=DIHYDROFOLATESYNTH-RXN}}
+

Revision as of 17:50, 10 January 2018

Reaction RXN-10039

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6281, L-selenocysteine biosynthesis II (archaea and eukaryotes): PWY-6281
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links