Difference between revisions of "Tiso gene 18937"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_18274 == * left end position: ** 2062 * transcription direction: ** POSITIVE * right end position: ** 3027 * centisome position: ** 66.0474...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18274 == |
− | * | + | * left end position: |
− | ** | + | ** 2062 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3027 |
− | * | + | * centisome position: |
− | ** | + | ** 66.04741 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[HISTONE-ACETYLTRANSFERASE-RXN]] | |
− | + | ** in-silico_annotation | |
− | * [[ | + | ***ec-number |
− | * | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=2062}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3027}} | |
− | + | {{#set: centisome position=66.04741 }} | |
− | + | {{#set: reaction associated=HISTONE-ACETYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:51, 10 January 2018
Gene Tiso_gene_18274
- left end position:
- 2062
- transcription direction:
- POSITIVE
- right end position:
- 3027
- centisome position:
- 66.04741
- Synonym(s):
Reactions associated
- HISTONE-ACETYLTRANSFERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation