Difference between revisions of "RXN66-476"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == * smiles: ** C(O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin light-cha...") |
(Created page with "Category:Gene == Gene Tiso_gene_13706 == * Synonym(s): == Reactions associated == * Forthi ** pantograph-creinhardtii == Pathways associated == == External li...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13706 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * [[Forthi]] | |
− | + | ** [[pantograph]]-[[creinhardtii]] | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=Forthi}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 17:51, 10 January 2018
Gene Tiso_gene_13706
- Synonym(s):