Difference between revisions of "PYRIDOXAMINE-5P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_15046 == * left end position: ** 181 * transcription direction: ** POSITIVE * right end position: ** 1538 * centisome position: ** 3.433883...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] ==
+
== Gene Tiso_gene_15046 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 181
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** linoleoyl-CoA
+
** 1538
−
* molecular weight:
+
* centisome position:
−
** 1025.937    
+
** 3.4338837    
 
* Synonym(s):
 
* Synonym(s):
−
** cis,cis-octadeca-9,12-dienoyl-CoA
 
−
** (9Z,12Z)-octadeca-9,12-dienoyl-CoA
 
−
** 18:2(n-6)
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[1.14.19.3-RXN]]
+
* [[PHOSPHOLIPASE-A2-RXN]]
−
* [[RXN-16094]]
+
** in-silico_annotation
−
* [[LINOLEOYL-RXN]]
+
***ec-number
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-15065]]
−
* [[LNLCCOAL]]
+
** in-silico_annotation
−
* [[RXN-9673]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-15067]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-15068]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-16138]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-16139]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-17735]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-17736]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN0-6725]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY66-397]]
 +
* [[PWY-6803]]
 +
* [[PWY-7409]]
 +
* [[PWY66-394]]
 +
* [[PWY66-395]]
 +
* [[PWY-7783]]
 +
* [[PWY-7417]]
 +
* [[PWY-7416]]
 +
* [[LIPASYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=181}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245440 25245440]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1538}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57383 57383]
+
{{#set: centisome position=3.4338837   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PHOSPHOLIPASE-A2-RXN|RXN-15065|RXN-15067|RXN-15068|RXN-16138|RXN-16139|RXN-17735|RXN-17736|RXN0-6725}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02050 C02050]
+
{{#set: pathway associated=PWY66-397|PWY-6803|PWY-7409|PWY66-394|PWY66-395|PWY-7783|PWY-7417|PWY-7416|LIPASYN-PWY}}
−
* HMDB : HMDB01064
+
−
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J}}
+
−
{{#set: common name=linoleoyl-CoA}}
+
−
{{#set: molecular weight=1025.937   }}
+
−
{{#set: common name=cis,cis-octadeca-9,12-dienoyl-CoA|(9Z,12Z)-octadeca-9,12-dienoyl-CoA|18:2(n-6)}}
+
−
{{#set: consumed by=1.14.19.3-RXN|RXN-16094|LINOLEOYL-RXN}}
+
−
{{#set: produced by=LNLCCOAL|RXN-9673}}
+

Revision as of 16:51, 10 January 2018

Gene Tiso_gene_15046

  • left end position:
    • 181
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1538
  • centisome position:
    • 3.4338837
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PYRIDOXAMINE-5P&oldid=14969"