Difference between revisions of "Tiso gene 2253"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALLO-THREONINE L-ALLO-THREONINE] == * smiles: ** CC(O)C([N+])C(=O)[O-] * inchi key: ** InChIK...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8228 RXN-8228] == * direction: ** LEFT-TO-RIGHT * common name: ** delphinidin 3-O-glucoside 5-O...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ALLO-THREONINE L-ALLO-THREONINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8228 RXN-8228] ==
−
* smiles:
+
* direction:
−
** CC(O)C([N+])C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=AYFVYJQAPQTCCC-HRFVKAFMSA-N
+
 
* common name:
 
* common name:
−
** L-allo-threonine
+
** delphinidin 3-O-glucoside 5-O-glucosyltransferase
−
* molecular weight:
+
* ec number:
−
** 119.12   
+
** [http://enzyme.expasy.org/EC/2.4.1.298 EC-2.4.1.298]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16001]]
+
* With identifiers:
−
* [[RXN-16000]]
+
** 1 [[CPD-7117]][c] '''+''' 1 [[CPD-12575]][c] '''=>''' 1 [[CPD-7139]][c] '''+''' 1 [[UDP]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 delphinidin-3-O-β-D-glucoside[c] '''+''' 1 UDP-α-D-glucose[c] '''=>''' 1 delphinidin 3,5-di-O-β-D-glucoside[c] '''+''' 1 UDP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3452]]
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways  ==
 +
* [[PWY-5307]], gentiodelphin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5307 PWY-5307]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[athaliana]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=206283 206283]
+
{{#set: common name=delphinidin 3-O-glucoside 5-O-glucosyltransferase}}
−
* CAS : 28954-12-3
+
{{#set: ec number=EC-2.4.1.298}}
−
* METABOLIGHTS : MTBLC58585
+
{{#set: gene associated=Tiso_gene_3452}}
−
* PUBCHEM:
+
{{#set: in pathway=PWY-5307}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6995276 6995276]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB04041
+
{{#set: reconstruction tool=pantograph}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=athaliana}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05519 C05519]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58585 58585]
+
−
* BIGG : athr__L
+
−
{{#set: smiles=CC(O)C([N+])C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=AYFVYJQAPQTCCC-HRFVKAFMSA-N}}
+
−
{{#set: common name=L-allo-threonine}}
+
−
{{#set: molecular weight=119.12    }}
+
−
{{#set: consumed by=RXN-16001|RXN-16000}}
+

Revision as of 17:52, 10 January 2018

Reaction RXN-8228

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • delphinidin 3-O-glucoside 5-O-glucosyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 delphinidin-3-O-β-D-glucoside[c] + 1 UDP-α-D-glucose[c] => 1 delphinidin 3,5-di-O-β-D-glucoside[c] + 1 UDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5307, gentiodelphin biosynthesis: PWY-5307
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2253&oldid=15028"