Difference between revisions of "SCOPOLETIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17232 == * left end position: ** 88 * transcription direction: ** POSITIVE * right end position: ** 1405 * centisome position: ** 2.2916667...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
+
== Gene Tiso_gene_17232 ==
−
* smiles:
+
* left end position:
−
** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
+
** 88
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-hydroxy-2-nonenal-glutathione conjugate
+
** 1405
−
* molecular weight:
+
* centisome position:
−
** 462.537    
+
** 2.2916667    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[GLYCPDIESTER-RXN]]
−
* [[RXN-13673]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[RXN-14073]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-14136]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-14160]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 +
* [[PWY-6952]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=88}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}}
+
{{#set: right end position=1405}}
−
{{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}}
+
{{#set: centisome position=2.2916667    }}
−
{{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}}
+
{{#set: reaction associated=GLYCPDIESTER-RXN|RXN-14073|RXN-14136|RXN-14160}}
−
{{#set: molecular weight=462.537    }}
+
{{#set: pathway associated=PWY-7409|PWY-6952}}
−
{{#set: produced by=RXN-13673}}
+

Revision as of 16:54, 10 January 2018

Gene Tiso_gene_17232

  • left end position:
    • 88
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1405
  • centisome position:
    • 2.2916667
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=SCOPOLETIN&oldid=15208"