Difference between revisions of "TREHALOSE-6P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == * smiles: ** COC1(=C(O)C=CC(C(O)CO)=C1) * inchi key: ** InChIKey=FBWPWW...") |
(Created page with "Category:Gene == Gene Tiso_gene_19716 == * left end position: ** 747 * transcription direction: ** POSITIVE * right end position: ** 1738 * centisome position: ** 35.84453...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_19716 == |
| − | * | + | * left end position: |
| − | ** | + | ** 747 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 1738 |
| − | * | + | * centisome position: |
| − | ** | + | ** 35.84453 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | + | * [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]] | |
| − | + | ** in-silico_annotation | |
| − | * [[ | + | ***ec-number |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=747}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: right end position=1738}} | |
| − | + | {{#set: centisome position=35.84453 }} | |
| − | + | {{#set: reaction associated=PROTEIN-TYROSINE-PHOSPHATASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 16:54, 10 January 2018
Gene Tiso_gene_19716
- left end position:
- 747
- transcription direction:
- POSITIVE
- right end position:
- 1738
- centisome position:
- 35.84453
- Synonym(s):
Reactions associated
- PROTEIN-TYROSINE-PHOSPHATASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
