Difference between revisions of "RXN-11662"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15740 RXN-15740] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-]...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15740 RXN-15740] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.1.5.3 EC-1.1.5.3]
+
** InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
 +
* common name:
 +
** α,α-trehalose 6-phosphate
 +
* molecular weight:
 +
** 420.263   
 
* Synonym(s):
 
* Synonym(s):
 +
** α,α-D-trehalose 6-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[TREHALOSEPHOSPHA-RXN]]
−
** 1 [[GLYCEROL-3P]][c] '''+''' 1 [[Menaquinones]][c] '''=>''' 1 [[Menaquinols]][c] '''+''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[UG6PGT]]
−
** 1 sn-glycerol 3-phosphate[c] '''+''' 1 a menaquinone[c] '''=>''' 1 a menaquinol[c] '''+''' 1 glycerone phosphate[c]
+
* [[UG6PGTn]]
−
 
+
* [[TREHALOSE6PSYN-RXN]]
−
== Genes associated with this reaction  ==
+
== Reaction(s) of unknown directionality ==
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15777]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY0-1582]], glycerol-3-phosphate to fumarate electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1582 PWY0-1582]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY0-1581]], nitrate reduction IX (dissimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1581 PWY0-1581]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 4484-88-2
−
{{#set: ec number=EC-1.1.5.3}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_15777}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105]
−
{{#set: in pathway=PWY0-1582|PWY0-1581}}
+
* HMDB : HMDB01124
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00689 C00689]
−
{{#set: reconstruction source=esiliculosus}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429]
 +
* BIGG : tre6p
 +
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}}
 +
{{#set: inchi key=InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L}}
 +
{{#set: common name=α,α-trehalose 6-phosphate}}
 +
{{#set: molecular weight=420.263    }}
 +
{{#set: common name=α,α-D-trehalose 6-phosphate}}
 +
{{#set: consumed by=TREHALOSEPHOSPHA-RXN}}
 +
{{#set: produced by=UG6PGT|UG6PGTn|TREHALOSE6PSYN-RXN}}

Revision as of 17:55, 10 January 2018

Metabolite TREHALOSE-6P

  • smiles:
    • C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
  • inchi key:
    • InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
  • common name:
    • α,α-trehalose 6-phosphate
  • molecular weight:
    • 420.263
  • Synonym(s):
    • α,α-D-trehalose 6-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 4484-88-2
  • PUBCHEM:
  • HMDB : HMDB01124
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : tre6p
"C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-11662&oldid=15291"