Difference between revisions of "RXN-22"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TETRADECANOYL-COA TETRADECANOYL-COA] == * smiles: ** CCCCCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TETRADECANOYL-COA TETRADECANOYL-COA] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=DUAFKXOFBZQTQE-QSGBVPJFSA-J |
* common name: | * common name: | ||
| − | ** | + | ** myristoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 973.861 |
* Synonym(s): | * Synonym(s): | ||
| + | ** Tetradecanoyl-CoA (n-C14:0CoA) | ||
| + | ** tetradecanoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17021]] | ||
| + | * [[RXN-14131]] | ||
| + | * [[ACACT7m]] | ||
| + | * [[RXN-17023]] | ||
| + | * [[ACOA140or]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.3.1.155-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.3.1.97-RXN]] | ||
| + | * [[ACACT7]] | ||
== External links == | == External links == | ||
| + | * BIGG : tdcoa | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244582 25244582] |
| − | * HMDB : | + | * HMDB : HMDB01521 |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02593 C02593] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57385 57385] |
| − | {{#set: produced by= | + | * METABOLIGHTS : MTBLC57385 |
| + | {{#set: smiles=CCCCCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=DUAFKXOFBZQTQE-QSGBVPJFSA-J}} | ||
| + | {{#set: common name=myristoyl-CoA}} | ||
| + | {{#set: molecular weight=973.861 }} | ||
| + | {{#set: common name=Tetradecanoyl-CoA (n-C14:0CoA)|tetradecanoyl-CoA}} | ||
| + | {{#set: consumed by=RXN-17021|RXN-14131|ACACT7m|RXN-17023|ACOA140or}} | ||
| + | {{#set: produced by=2.3.1.155-RXN}} | ||
| + | {{#set: consumed or produced by=2.3.1.97-RXN|ACACT7}} | ||
Revision as of 17:56, 10 January 2018
Contents
Metabolite TETRADECANOYL-COA
- smiles:
- CCCCCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=DUAFKXOFBZQTQE-QSGBVPJFSA-J
- common name:
- myristoyl-CoA
- molecular weight:
- 973.861
- Synonym(s):
- Tetradecanoyl-CoA (n-C14:0CoA)
- tetradecanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : tdcoa
- PUBCHEM:
- HMDB : HMDB01521
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57385
"CCCCCCCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
