Difference between revisions of "RXN-14107"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9068 == * left end position: ** 105 * transcription direction: ** POSITIVE * right end position: ** 6140 * centisome position: ** 1.0901163...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-COA FORMYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-COA FORMYL-COA] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * common name: |
| − | ** | + | ** formyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SXMOKYXNAPLNCW-GORZOVPNSA-J |
| − | * | + | * molecular weight: |
| − | ** | + | ** 791.513 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00798 C00798] |
| − | {{#set: | + | * HMDB : HMDB03419 |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57376 57376] |
| + | * METABOLIGHTS : MTBLC57376 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266602 45266602] | ||
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: common name=formyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=SXMOKYXNAPLNCW-GORZOVPNSA-J}} | ||
| + | {{#set: molecular weight=791.513 }} | ||
| + | {{#set: produced by=RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.}} | ||
Revision as of 16:57, 10 January 2018
Contents
Metabolite FORMYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- formyl-CoA
- inchi key:
- InChIKey=SXMOKYXNAPLNCW-GORZOVPNSA-J
- molecular weight:
- 791.513
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
