Difference between revisions of "Tiso gene 16719"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == * smiles: ** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3...")
 
(Created page with "Category:Gene == Gene Tiso_gene_9355 == * left end position: ** 612 * transcription direction: ** POSITIVE * right end position: ** 2445 * centisome position: ** 6.5064855...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] ==
+
== Gene Tiso_gene_9355 ==
−
* smiles:
+
* left end position:
−
** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
+
** 612
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** mycophenolic acid O-acyl-glucuronide
+
** 2445
−
* molecular weight:
+
* centisome position:
−
** 495.459    
+
** 6.5064855    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
−
* [[RXN-13607]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=612}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678773 70678773]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2445}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66982 66982]
+
{{#set: centisome position=6.5064855   }}
−
{{#set: smiles=CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)}}
+
{{#set: reaction associated=METHIONYL-TRNA-FORMYLTRANSFERASE-RXN}}
−
{{#set: inchi key=InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M}}
+
−
{{#set: common name=mycophenolic acid O-acyl-glucuronide}}
+
−
{{#set: molecular weight=495.459   }}
+
−
{{#set: produced by=RXN-13607}}
+

Revision as of 16:57, 10 January 2018

Gene Tiso_gene_9355

  • left end position:
    • 612
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2445
  • centisome position:
    • 6.5064855
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16719&oldid=15417"