Difference between revisions of "RXN-18201"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINONONANOATE DIAMINONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)[N+])[N+] * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_12341 == * Synonym(s): == Reactions associated == * RXN-1224 ** pantograph-esiliculosus * RXN-15117 ** pantograph-at...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12341 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-1224]] |
− | + | ** [[pantograph]]-[[esiliculosus]] | |
− | == | + | * [[RXN-15117]] |
− | * [[ | + | ** [[pantograph]]-[[athaliana]] |
+ | == Pathways associated == | ||
+ | * [[PWY-7817]] | ||
+ | * [[PWYQT-4427]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-1224|RXN-15117}} | |
− | + | {{#set: pathway associated=PWY-7817|PWYQT-4427}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 17:57, 10 January 2018
Gene Tiso_gene_12341
- Synonym(s):