Difference between revisions of "CPD-15382"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Gene == Gene Tiso_gene_8434 == * Synonym(s): == Reactions associated == * PEPTIDYLPROLYL-ISOMERASE-RXN ** in-silico_annotation ***ec-number == Pathways assoc...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_8434 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
| − | + | ** in-silico_annotation | |
| − | == | + | ***ec-number |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 16:57, 10 January 2018
Gene Tiso_gene_8434
- Synonym(s):
Reactions associated
- PEPTIDYLPROLYL-ISOMERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
