Difference between revisions of "Tiso gene 18559"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.125-RXN 2.4.1.125-RXN] == * direction: ** REVERSIBLE * common name: ** morn_repeat_protein *...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.125-RXN 2.4.1.125-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(=O)(C1(O)(C=CCCC(=O)1))[O-]
 +
* inchi key:
 +
** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** morn_repeat_protein
+
** 6-hydroxy-2-cyclohexen-one-carboxylate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.4.1.5 EC-2.4.1.5]
+
** 155.13   
−
** [http://enzyme.expasy.org/EC/2.4.1.125 EC-2.4.1.125]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-hydroxy-2-cyclohexen-one-carboxylic acid
 +
** HCC
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[SUCROSE]][c] '''+''' 1 [[1-6-alpha-D-glucan]][c] '''<=>''' 1 [[1-6-alpha-D-glucan]][c] '''+''' 1 [[Fructofuranose]][c]
+
* [[RXN-12252]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 sucrose[c] '''+''' 1 a 1-6-&alpha;-D-glucan[c] '''<=>''' 1 a 1-6-&alpha;-D-glucan[c] '''+''' 1 D-fructofuranose[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3363]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02120 R02120]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166]
−
* UNIPROT:
+
{{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}}
−
** [http://www.uniprot.org/uniprot/O52224 O52224]
+
{{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}}
−
** [http://www.uniprot.org/uniprot/Q7M102 Q7M102]
+
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}}
−
** [http://www.uniprot.org/uniprot/Q7M0M1 Q7M0M1]
+
{{#set: molecular weight=155.13    }}
−
** [http://www.uniprot.org/uniprot/P13470 P13470]
+
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}}
−
** [http://www.uniprot.org/uniprot/Q48756 Q48756]
+
{{#set: produced by=RXN-12252}}
−
** [http://www.uniprot.org/uniprot/Q9CDJ6 Q9CDJ6]
+
−
** [http://www.uniprot.org/uniprot/Q9CDJ7 Q9CDJ7]
+
−
** [http://www.uniprot.org/uniprot/Q54178 Q54178]
+
−
** [http://www.uniprot.org/uniprot/Q7M0L7 Q7M0L7]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=morn_repeat_protein}}
+
−
{{#set: ec number=EC-2.4.1.5}}
+
−
{{#set: ec number=EC-2.4.1.125}}
+
−
{{#set: gene associated=Tiso_gene_3363}}
+
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 16:58, 10 January 2018

Metabolite CPD-13172

  • smiles:
    • C(=O)(C1(O)(C=CCCC(=O)1))[O-]
  • inchi key:
    • InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
  • common name:
    • 6-hydroxy-2-cyclohexen-one-carboxylate
  • molecular weight:
    • 155.13
  • Synonym(s):
    • 6-hydroxy-2-cyclohexen-one-carboxylic acid
    • HCC

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)(C1(O)(C=CCCC(=O)1))[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18559&oldid=15456"