Difference between revisions of "RXN-7647"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7647 RXN-7647] == * direction: ** LEFT-TO-RIGHT * common name: ** atp-dependent_rna_helicase_dh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == * smiles: ** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC) |
| + | * inchi key: | ||
| + | ** InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** mycophenolic acid O-acyl-glucuronide |
| − | * | + | * molecular weight: |
| − | ** | + | ** 495.459 |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-13607]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678773 70678773] |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66982 66982] | |
| − | + | {{#set: smiles=CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)}} | |
| − | + | {{#set: inchi key=InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M}} | |
| − | {{#set: | + | {{#set: common name=mycophenolic acid O-acyl-glucuronide}} |
| − | + | {{#set: molecular weight=495.459 }} | |
| − | + | {{#set: produced by=RXN-13607}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:58, 10 January 2018
Contents
Metabolite CPD-14602
- smiles:
- CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
- inchi key:
- InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
- common name:
- mycophenolic acid O-acyl-glucuronide
- molecular weight:
- 495.459
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)" cannot be used as a page name in this wiki.
