Difference between revisions of "Pyruvate-dehydrogenases"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * smiles: ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tubulin-L-Lysine Tubulin-L-Lysine] == * common name: ** an [α-tubuline]-L-lysine * Synony...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tubulin-L-Lysine Tubulin-L-Lysine] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an [α-tubuline]-L-lysine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[TUBULIN-N-ACETYLTRANSFERASE-RXN]] |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an [α-tubuline]-L-lysine}} | |
| − | + | {{#set: consumed or produced by=TUBULIN-N-ACETYLTRANSFERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: consumed | + | |
| − | + | ||
| − | + | ||
Revision as of 16:58, 10 January 2018
Contents
Metabolite Tubulin-L-Lysine
- common name:
- an [α-tubuline]-L-lysine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an [α-tubuline]-L-lysine" cannot be used as a page name in this wiki.
