Difference between revisions of "Pyruvate-dehydrogenases"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * smiles: ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) * inchi...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tubulin-L-Lysine Tubulin-L-Lysine] == * common name: ** an [α-tubuline]-L-lysine * Synony...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tubulin-L-Lysine Tubulin-L-Lysine] ==
* smiles:
+
** C(O)C(O)C1(C(=O)C(=O)C(=O)O1)
+
* inchi key:
+
** InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N
+
 
* common name:
 
* common name:
** L-dehydro-ascorbate
+
** an [α-tubuline]-L-lysine
* molecular weight:
+
** 174.11   
+
 
* Synonym(s):
 
* Synonym(s):
** dehydroascorbate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12862]]
 
* [[RXN-12869]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-3523]]
 
* [[RXN-12440]]
 
* [[RXN-7984]]
 
* [[RXN-7985]]
 
* [[PEPTIDYLGLYCINE-MONOOXYGENASE-RXN]]
 
* [[RXN-12876]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-13185]]
+
* [[TUBULIN-N-ACETYLTRANSFERASE-RXN]]
* [[RXN-13183]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=an [α-tubuline]-L-lysine}}
** [http://www.genome.jp/dbget-bin/www_bget?C05422 C05422]
+
{{#set: consumed or produced by=TUBULIN-N-ACETYLTRANSFERASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58070 58070]
+
* METABOLIGHTS : MTBLC58070
+
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15558810 15558810]
+
* HMDB : HMDB01264
+
{{#set: smiles=C(O)C(O)C1(C(=O)C(=O)C(=O)O1)}}
+
{{#set: inchi key=InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N}}
+
{{#set: common name=L-dehydro-ascorbate}}
+
{{#set: molecular weight=174.11    }}
+
{{#set: common name=dehydroascorbate}}
+
{{#set: consumed by=RXN-12862|RXN-12869}}
+
{{#set: produced by=RXN-3523|RXN-12440|RXN-7984|RXN-7985|PEPTIDYLGLYCINE-MONOOXYGENASE-RXN|RXN-12876}}
+
{{#set: consumed or produced by=RXN-13185|RXN-13183}}
+

Revision as of 16:58, 10 January 2018

Metabolite Tubulin-L-Lysine

  • common name:
    • an [α-tubuline]-L-lysine
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [α-tubuline]-L-lysine" cannot be used as a page name in this wiki.