|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GSHTRAN-RXN GSHTRAN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-3-GLUCOSIDE-CMPD PELARGONIDIN-3-GLUCOSIDE-CMPD] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(=CC4(=C([O+]=C(C2(=CC=C(O)C=C2))3)C=C(C=C([O-])4)[O-]))) |
| + | * inchi key: |
| + | ** InChIKey=ABVCUBUIXWJYSE-GQUPQBGVSA-M |
| * common name: | | * common name: |
− | ** glutathione_s-transferase | + | ** pelargonidin-3-O-β-D-glucoside |
− | ** glutathione_s-
| + | * molecular weight: |
− | ** ORF
| + | ** 431.375 |
− | ** phi_class_glutathione_s-transferase
| + | |
− | * ec number: | + | |
− | ** [http://enzyme.expasy.org/EC/2.5.1.18 EC-2.5.1.18] | + | |
| * Synonym(s): | | * Synonym(s): |
| + | ** callistephin |
| + | ** 3-(β-D-glucopyranosyloxy)-55,7-dihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-7828]] |
− | ** 1 [[RX]][c] '''+''' 1 [[GLUTATHIONE]][c] '''=>''' 1 [[HX]][c] '''+''' 1 [[S-Substituted-Glutathione]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 RX[c] '''+''' 1 glutathione[c] '''=>''' 1 HX[c] '''+''' 1 a glutathione-toxin conjugate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_5129]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_8389]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_1104]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | * [[Tiso_gene_19791]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | * [[Tiso_gene_1666]]
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | * [[Tiso_gene_2775]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | ** [[pantograph]]-[[athaliana]]
| + | |
− | * [[Tiso_gene_3535]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_8508]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_19041]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_6036]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_3233]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_8509]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_20110]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways == | + | |
− | * [[PWY-6842]], glutathione-mediated detoxification II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6842 PWY-6842]
| + | |
− | ** '''2''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-4061]], glutathione-mediated detoxification I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4061 PWY-4061]
| + | |
− | ** '''2''' reactions found over '''5''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[athaliana]]
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R03522 R03522] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515300 102515300] |
− | * UNIPROT:
| + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P30116 P30116]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31967 31967] |
− | ** [http://www.uniprot.org/uniprot/P04903 P04903]
| + | * METABOLIGHTS : MTBLC31967 |
− | ** [http://www.uniprot.org/uniprot/P04904 P04904] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P13745 P13745] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12137 C12137] |
− | ** [http://www.uniprot.org/uniprot/P08011 P08011]
| + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(=CC4(=C([O+]=C(C2(=CC=C(O)C=C2))3)C=C(C=C([O-])4)[O-])))}} |
− | ** [http://www.uniprot.org/uniprot/Q7M0B7 Q7M0B7]
| + | {{#set: inchi key=InChIKey=ABVCUBUIXWJYSE-GQUPQBGVSA-M}} |
− | ** [http://www.uniprot.org/uniprot/P08009 P08009] | + | {{#set: common name=pelargonidin-3-O-β-D-glucoside}} |
− | ** [http://www.uniprot.org/uniprot/P04905 P04905] | + | {{#set: molecular weight=431.375 }} |
− | ** [http://www.uniprot.org/uniprot/P21266 P21266] | + | {{#set: common name=callistephin|3-(β-D-glucopyranosyloxy)-55,7-dihydroxy-2-(4-hydroxyphenyl)-1-benzopyrylium chloride}} |
− | ** [http://www.uniprot.org/uniprot/P09211 P09211]
| + | {{#set: consumed by=RXN-7828}} |
− | ** [http://www.uniprot.org/uniprot/P28161 P28161]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08863 Q08863]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30109 P30109]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28338 P28338]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46088 P46088]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15964 P15964]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46439 P46439]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9VG97 Q9VG97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03013 Q03013]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41043 P41043]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28801 P28801]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46418 P46418]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46425 P46425]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A9D2 P0A9D2]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08263 P08263]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30712 P30712]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9NAW7 Q9NAW7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08515 P08515]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10620 P10620]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19639 P19639]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WU21 Q9WU21]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15626 P15626]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08862 Q08862]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26624 P26624]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03377 Q03377]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19157 P19157]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20137 P20137]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9VG95 Q9VG95]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9VG98 Q9VG98]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9VG96 Q9VG96]
| + | |
− | ** [http://www.uniprot.org/uniprot/O31817 O31817]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8X6U4 Q8X6U4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30713 P30713]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42706 Q42706]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q28514 Q28514]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9TXB7 Q9TXB7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09792 P09792]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16413 P16413]
| + | |
− | ** [http://www.uniprot.org/uniprot/P81706 P81706]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09488 P09488]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M446 Q7M446]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10299 P10299]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0B6 Q7M0B6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0C0 Q7M0C0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F7 Q7M0F7]
| + | |
− | ** [http://www.uniprot.org/uniprot/P22416 P22416]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30102 P30102]
| + | |
− | ** [http://www.uniprot.org/uniprot/P28342 P28342]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24473 P24473]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F4 Q7M0F4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F3 Q7M0F3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26697 P26697]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PS57 Q9PS57]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JLQ6 Q9JLQ6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30115 P30115]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09210 P09210]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01579 Q01579]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24472 P24472]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F5 Q7M0F5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F6 Q7M0F6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F2 Q7M0F2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9TQQ8 Q9TQQ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0B8 Q7M0B8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M059 Q7M059]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30568 P30568]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q03425 Q03425]
| + | |
− | ** [http://www.uniprot.org/uniprot/P10649 P10649]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46422 P46422]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45875 P45875]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42769 P42769]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46436 P46436]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0F1 Q7M0F1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42760 P42760]
| + | |
− | ** [http://www.uniprot.org/uniprot/P42761 P42761]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9GQE3 Q9GQE3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46427 P46427]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48438 P48438]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08392 Q08392]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q08393 Q08393]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30711 P30711]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UDH6 Q9UDH6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UDH3 Q9UDH3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UDH2 Q9UDH2]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UDH1 Q9UDH1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46432 P46432]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46433 P46433]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46420 P46420]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27013 P27013]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27014 P27014]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20135 P20135]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46409 P46409]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46421 P46421]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46431 P46431]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0B9 Q7M0B9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M3E7 Q7M3E7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M3E8 Q7M3E8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M3E9 Q7M3E9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q64471 Q64471]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q91VB0 Q91VB0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15214 P15214]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47954 P47954]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60550 Q60550]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q12760 Q12760]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65032 O65032]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65857 O65857]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82451 O82451]
| + | |
− | ** [http://www.uniprot.org/uniprot/O24595 O24595]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49235 O49235]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04437 O04437]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30110 P30110]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30111 P30111]
| + | |
− | ** [http://www.uniprot.org/uniprot/O04874 O04874]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32111 P32111]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22330 O22330]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49821 O49821]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65344 O65344]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81602 O81602]
| + | |
− | ** [http://www.uniprot.org/uniprot/O85984 O85984]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q21355 Q21355]
| + | |
− | ** [http://www.uniprot.org/uniprot/O16115 O16115]
| + | |
− | ** [http://www.uniprot.org/uniprot/O16116 O16116]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRT5 Q9ZRT5]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRW8 Q9ZRW8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SM20 Q9SM20]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZP62 Q9ZP62]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZS18 Q9ZS18]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZS16 Q9ZS16]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SB97 Q9SB97]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZS17 Q9ZS17]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZRR6 Q9ZRR6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P20432 P20432]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14942 P14942]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08010 P08010]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04906 P04906]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12653 P12653]
| + | |
− | ** [http://www.uniprot.org/uniprot/P04907 P04907]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=glutathione_s-transferase}} | + | |
− | {{#set: common name=glutathione_s-}} | + | |
− | {{#set: common name=ORF}} | + | |
− | {{#set: common name=phi_class_glutathione_s-transferase}} | + | |
− | {{#set: ec number=EC-2.5.1.18}}
| + | |
− | {{#set: gene associated=Tiso_gene_5129|Tiso_gene_8389|Tiso_gene_1104|Tiso_gene_19791|Tiso_gene_1666|Tiso_gene_2775|Tiso_gene_3535|Tiso_gene_8508|Tiso_gene_19041|Tiso_gene_6036|Tiso_gene_3233|Tiso_gene_8509|Tiso_gene_20110}}
| + | |
− | {{#set: in pathway=PWY-6842|PWY-4061}}
| + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=athaliana|esiliculosus}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |