Difference between revisions of "Tiso gene 4740"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-VAL-tRNAs Charged-VAL-tRNAs] == * common name: ** an L-valyl-[tRNAval] * Synonym(s): =...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-VAL-tRNAs Charged-VAL-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2231 CPD0-2231] ==
 +
* smiles:
 +
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
 +
* inchi key:
 +
** InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
 
* common name:
 
* common name:
** an L-valyl-[tRNAval]
+
** dIDP
 +
* molecular weight:
 +
** 409.165   
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxyinosine diphosphate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[VALINE--TRNA-LIGASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-14228]]
 
== External links  ==
 
== External links  ==
{{#set: common name=an L-valyl-[tRNAval]}}
+
* LIGAND-CPD:
{{#set: produced by=VALINE--TRNA-LIGASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01344 C01344]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62286 62286]
 +
* BIGG : didp
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173552 46173552]
 +
* HMDB : HMDB03536
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}}
 +
{{#set: inchi key=InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K}}
 +
{{#set: common name=dIDP}}
 +
{{#set: molecular weight=409.165    }}
 +
{{#set: common name=deoxyinosine diphosphate}}
 +
{{#set: consumed or produced by=RXN-14228}}

Revision as of 17:59, 10 January 2018

Metabolite CPD0-2231

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
  • inchi key:
    • InChIKey=BKUSIKGSPSFQAC-RRKCRQDMSA-K
  • common name:
    • dIDP
  • molecular weight:
    • 409.165
  • Synonym(s):
    • deoxyinosine diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.