Difference between revisions of "RXN-7677"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.48-RXN 3.2.1.48-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** sphingomyelinase * ec...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == * smiles: ** COC1(C=C(C=CC=O)C=C(OC)C(O)=1) * inchi key: ** InC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == |
− | * | + | * smiles: |
− | ** | + | ** COC1(C=C(C=CC=O)C=C(OC)C(O)=1) |
+ | * inchi key: | ||
+ | ** InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** sinapaldehyde |
− | * | + | * molecular weight: |
− | ** | + | ** 208.213 |
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-1125]] |
− | + | * [[RXN-8014]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-1143]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RXN-1124]] |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280802 5280802] |
− | * LIGAND- | + | * CHEMSPIDER: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.chemspider.com/Chemical-Structure.4444359.html 4444359] |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27949 27949] | |
− | {{#set: | + | * METABOLIGHTS : MTBLC27949 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05610 C05610] |
− | {{#set: | + | {{#set: smiles=COC1(C=C(C=CC=O)C=C(OC)C(O)=1)}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N}} |
− | {{#set: | + | {{#set: common name=sinapaldehyde}} |
− | + | {{#set: molecular weight=208.213 }} | |
+ | {{#set: consumed by=RXN-1125|RXN-8014}} | ||
+ | {{#set: produced by=RXN-1143}} | ||
+ | {{#set: consumed or produced by=RXN-1124}} |
Revision as of 16:59, 10 January 2018
Contents
Metabolite SINAPALDEHYDE
- smiles:
- COC1(C=C(C=CC=O)C=C(OC)C(O)=1)
- inchi key:
- InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N
- common name:
- sinapaldehyde
- molecular weight:
- 208.213
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links