Difference between revisions of "Tiso gene 16712"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-D-GLUCOSE DTDP-D-GLUCOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=All-trans-Retinyl-Esters All-trans-Retinyl-Esters] == * common name: ** an all-trans-retinyl es...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-D-GLUCOSE DTDP-D-GLUCOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=All-trans-Retinyl-Esters All-trans-Retinyl-Esters] ==
* smiles:
+
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(CO)C(O)C(O)C(O)2))O3))
+
* inchi key:
+
** InChIKey=YSYKRGRSMLTJNL-URARBOGNSA-L
+
 
* common name:
 
* common name:
** dTDP-α-D-glucose
+
** an all-trans-retinyl ester
* molecular weight:
+
** 562.317   
+
 
* Synonym(s):
 
* Synonym(s):
** TDP-glucose
 
** dTDP-glucose
 
** dTDP-D-glucose
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTDPGLUCDEHYDRAT-RXN]]
+
* [[RXN-12575]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[R02984]]
 
* [[DTDPGLUCOSEPP-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 2009-24-7
+
{{#set: common name=an all-trans-retinyl ester}}
* METABOLIGHTS : MTBLC57477
+
{{#set: consumed by=RXN-12575}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202390 25202390]
+
* HMDB : HMDB01328
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00842 C00842]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57477 57477]
+
* BIGG : dtdpglu
+
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(CO)C(O)C(O)C(O)2))O3))}}
+
{{#set: inchi key=InChIKey=YSYKRGRSMLTJNL-URARBOGNSA-L}}
+
{{#set: common name=dTDP-α-D-glucose}}
+
{{#set: molecular weight=562.317    }}
+
{{#set: common name=TDP-glucose|dTDP-glucose|dTDP-D-glucose}}
+
{{#set: consumed by=DTDPGLUCDEHYDRAT-RXN}}
+
{{#set: consumed or produced by=R02984|DTDPGLUCOSEPP-RXN}}
+

Revision as of 16:59, 10 January 2018

Metabolite All-trans-Retinyl-Esters

  • common name:
    • an all-trans-retinyl ester
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links