Difference between revisions of "RXN-161"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_6094 == * Synonym(s): == Reactions associated == * RXN0-5398 ** pantograph-esiliculosus == Pathways associated == * PWY-6019...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_6094 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * [[RXN0-5398]] |
| − | + | ** [[pantograph]]-[[esiliculosus]] | |
| − | * [[ | + | == Pathways associated == |
| − | == | + | * [[PWY-6019]] |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=RXN0-5398}} | |
| − | + | {{#set: pathway associated=PWY-6019}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:59, 10 January 2018
Gene Tiso_gene_6094
- Synonym(s):
