Difference between revisions of "Tiso gene 11797"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTMOHT MTMOHT] == * direction: ** LEFT-TO-RIGHT * common name: ** 5,10-Methylenetetrahydrofolate:3-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTMOHT MTMOHT] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 5,10-Methylenetetrahydrofolate:3-methyl-2-oxobutanoate hydroxymethyltransferase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1.0 [[2-KETO-ISOVALERATE]][m] '''+''' 1.0 [[WATER]][m] '''+''' 1.0 [[METHYLENE-THF]][m] '''=>''' 1.0 [[2-DEHYDROPANTOATE]][m] '''+''' 1.0 [[THF]][m] |
| − | == | + | * With common name(s): |
| + | ** 1.0 3-methyl-2-oxobutanoate[m] '''+''' 1.0 H2O[m] '''+''' 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[m] '''=>''' 1.0 2-dehydropantoate[m] '''+''' 1.0 tetrahydropteroyl mono-L-glutamate[m] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_14465]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[creinhardtii]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=5,10-Methylenetetrahydrofolate:3-methyl-2-oxobutanoate hydroxymethyltransferase}} | |
| − | + | {{#set: gene associated=Tiso_gene_14465}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=creinhardtii}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:02, 10 January 2018
Contents
Reaction MTMOHT
- direction:
- LEFT-TO-RIGHT
- common name:
- 5,10-Methylenetetrahydrofolate:3-methyl-2-oxobutanoate hydroxymethyltransferase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 2-KETO-ISOVALERATE[m] + 1.0 WATER[m] + 1.0 METHYLENE-THF[m] => 1.0 2-DEHYDROPANTOATE[m] + 1.0 THF[m]
- With common name(s):
- 1.0 3-methyl-2-oxobutanoate[m] + 1.0 H2O[m] + 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[m] => 1.0 2-dehydropantoate[m] + 1.0 tetrahydropteroyl mono-L-glutamate[m]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
