Difference between revisions of "2.7.7.13-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2505 == * Synonym(s): == Reactions associated == * LPLPS1AGPE180 ** pantograph-creinhardtii * LYSOPHOSPHOLIPASE-RXN ** p...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N | ||
+ | * common name: | ||
+ | ** γ-carotene | ||
+ | * molecular weight: | ||
+ | ** 536.882 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** β,ψ-carotene | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN1F-151]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN1F-150]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMPR01070260 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280791 5280791] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4444349.html 4444349] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27740 27740] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05435 C05435] | ||
+ | {{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N}} | ||
+ | {{#set: common name=γ-carotene}} | ||
+ | {{#set: molecular weight=536.882 }} | ||
+ | {{#set: common name=β,ψ-carotene}} | ||
+ | {{#set: consumed by=RXN1F-151}} | ||
+ | {{#set: produced by=RXN1F-150}} |
Revision as of 18:02, 10 January 2018
Contents
Metabolite CPD1F-126
- smiles:
- CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)C)C)C)C)C
- inchi key:
- InChIKey=HRQKOYFGHJYEFS-BXOLYSJBSA-N
- common name:
- γ-carotene
- molecular weight:
- 536.882
- Synonym(s):
- β,ψ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links