Difference between revisions of "Tiso gene 6812"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17893 RXN-17893] == * direction: ** LEFT-TO-RIGHT * common name: ** acylamino-acid-releasing_en...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17893 RXN-17893] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** acylamino-acid-releasing_enzyme |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.4.19.1 EC-3.4.19.1] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[N-Ac-L-methionyl-L-glutaminyl-Protein]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[L-Glutaminyl-Peptides]][c] '''+''' 1 [[CPD0-2015]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein][c] '''+''' 1 H2O[c] '''=>''' 1 an N-terminal L-glutaminyl-[protein][c] '''+''' 1 Nα-acetyl-L-methionine[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_3550]] | ||
| + | ** IN-SILICO_ANNOTATION | ||
| + | ***AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-7799]], Arg/N-end rule pathway (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799] | ||
| + | ** '''8''' reactions found over '''14''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=acylamino-acid-releasing_enzyme}} | |
| − | {{#set: | + | {{#set: ec number=EC-3.4.19.1}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_3550}} |
| − | {{#set: | + | {{#set: in pathway=PWY-7799}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | {{#set: reconstruction source=in-silico_annotation}} |
Revision as of 18:03, 10 January 2018
Contents
Reaction RXN-17893
- direction:
- LEFT-TO-RIGHT
- common name:
- acylamino-acid-releasing_enzyme
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 N-Ac-L-methionyl-L-glutaminyl-Protein[c] + 1 WATER[c] => 1 L-Glutaminyl-Peptides[c] + 1 CPD0-2015[c]
- With common name(s):
- 1 an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein][c] + 1 H2O[c] => 1 an N-terminal L-glutaminyl-[protein][c] + 1 Nα-acetyl-L-methionine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_3550
- IN-SILICO_ANNOTATION
- AUTOMATED-NAME-MATCH
- IN-SILICO_ANNOTATION
Pathways
- PWY-7799, Arg/N-end rule pathway (eukaryotic): PWY-7799
- 8 reactions found over 14 reactions in the full pathway
