Difference between revisions of "Alkyl-Hydro-Peroxides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] == * smiles: ** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14275 RXN-14275] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14275 RXN-14275] ==
−
* smiles:
+
* direction:
−
** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J
+
** [http://enzyme.expasy.org/EC/1.1.1.M19 EC-1.1.1.M19]
−
* common name:
+
−
** vinylacetyl-CoA
+
−
* molecular weight:
+
−
** 831.577   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-butenoyl-CoA
 
−
** but-3-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPD-14916]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD0-2106]][c]
−
* [[VINYLACETYL-COA-DELTA-ISOMERASE-RXN]]
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 (R)-3-hydroxyoctanoyl-CoA[c] '''=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 3-oxooctanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_14027]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_14026]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_5857]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6920]], 6-gingerol analog biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6920 PWY-6920]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266616 45266616]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31196 31196]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57396 57396]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04745 R04745]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02331 C02331]
+
{{#set: ec number=EC-1.1.1.M19}}
−
{{#set: smiles=C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: gene associated=Tiso_gene_14027|Tiso_gene_14026|Tiso_gene_5857}}
−
{{#set: inchi key=InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J}}
+
{{#set: in pathway=PWY-6920}}
−
{{#set: common name=vinylacetyl-CoA}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=831.577    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=3-butenoyl-CoA|but-3-enoyl-CoA}}
+
{{#set: reconstruction source=esiliculosus}}
−
{{#set: consumed or produced by=VINYLACETYL-COA-DELTA-ISOMERASE-RXN}}
+

Revision as of 18:06, 10 January 2018

Reaction RXN-14275

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 (R)-3-hydroxyoctanoyl-CoA[c] => 1 NADH[c] + 1 H+[c] + 1 3-oxooctanoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6920, 6-gingerol analog biosynthesis (engineered): PWY-6920
    • 5 reactions found over 6 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Alkyl-Hydro-Peroxides&oldid=16141"