Difference between revisions of "RXN66-13"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta13-3-oxo-lacceroyl-ACPs cis-delta13-3-oxo-lacceroyl-ACPs] == * common name: ** a cis-d...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * smiles:...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == |
+ | * smiles: | ||
+ | ** CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol |
+ | * molecular weight: | ||
+ | ** 597.259 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** CDP-ME-2P | ||
+ | ** CDP-methyl-D-erylthritol 2-phosphate | ||
+ | ** 4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate | ||
+ | ** 4-diphosphocytidyl-2-C-methylerythritol 2-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-302]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.7.1.148-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878430 46878430] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57919 57919] | ||
+ | * BIGG : 2p4c2me | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C11436 C11436] | ||
+ | {{#set: smiles=CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J}} | ||
+ | {{#set: common name=2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}} | ||
+ | {{#set: molecular weight=597.259 }} | ||
+ | {{#set: common name=CDP-ME-2P|CDP-methyl-D-erylthritol 2-phosphate|4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate|4-diphosphocytidyl-2-C-methylerythritol 2-phosphate}} | ||
+ | {{#set: consumed by=RXN0-302}} | ||
+ | {{#set: produced by=2.7.1.148-RXN}} |
Revision as of 18:07, 10 January 2018
Contents
Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET
- smiles:
- CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O
- inchi key:
- InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J
- common name:
- 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
- molecular weight:
- 597.259
- Synonym(s):
- CDP-ME-2P
- CDP-methyl-D-erylthritol 2-phosphate
- 4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate
- 4-diphosphocytidyl-2-C-methylerythritol 2-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O" cannot be used as a page name in this wiki.