Difference between revisions of "1.5.1.19-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10469 == * left end position: ** 5913 * transcription direction: ** NEGATIVE * right end position: ** 8490 * centisome position: ** 69.3932...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNITINE CARNITINE] == * smiles: ** C(C(O)CC(=O)[O-])[N+](C)(C)C * inchi key: ** InChIKey=PHIQ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNITINE CARNITINE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(O)CC(=O)[O-])[N+](C)(C)C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PHIQHXFUZVPYII-ZCFIWIBFSA-N |
− | * | + | * common name: |
− | ** | + | ** L-carnitine |
− | * | + | * molecular weight: |
− | ** | + | ** 161.2 |
* Synonym(s): | * Synonym(s): | ||
+ | ** γ-trimethyl-hydroxybutyrobetaine | ||
+ | ** 3-hydroxy-4-trimethylammoniobutanoate | ||
+ | ** R-(-)-3-hydroxy-4-trimethylaminobutyrate | ||
+ | ** vitamin B T | ||
+ | ** bicarnesine | ||
+ | ** (R)-carnitine | ||
+ | ** γ-L-trimethyl-β-hydroxybutyrobetaine | ||
+ | ** vitamin Bt | ||
+ | ** 3-carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN | + | == Reaction(s) known to produce the compound == |
− | + | * [[ACYLCARNITINE-HYDROLASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 44985-71-9 |
− | {{#set: | + | * CAS : 541-15-1 |
− | {{#set: | + | * METABOLIGHTS : MTBLC16347 |
− | {{#set: | + | * DRUGBANK : DB00583 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10917 10917] | ||
+ | * HMDB : HMDB14721 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00318 C00318] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.10455.html 10455] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16347 16347] | ||
+ | * BIGG : crn | ||
+ | {{#set: smiles=C(C(O)CC(=O)[O-])[N+](C)(C)C}} | ||
+ | {{#set: inchi key=InChIKey=PHIQHXFUZVPYII-ZCFIWIBFSA-N}} | ||
+ | {{#set: common name=L-carnitine}} | ||
+ | {{#set: molecular weight=161.2 }} | ||
+ | {{#set: common name=γ-trimethyl-hydroxybutyrobetaine|3-hydroxy-4-trimethylammoniobutanoate|R-(-)-3-hydroxy-4-trimethylaminobutyrate|vitamin B T|bicarnesine|(R)-carnitine|γ-L-trimethyl-β-hydroxybutyrobetaine|vitamin Bt|3-carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium}} | ||
+ | {{#set: produced by=ACYLCARNITINE-HYDROLASE-RXN}} |
Revision as of 17:07, 10 January 2018
Contents
Metabolite CARNITINE
- smiles:
- C(C(O)CC(=O)[O-])[N+](C)(C)C
- inchi key:
- InChIKey=PHIQHXFUZVPYII-ZCFIWIBFSA-N
- common name:
- L-carnitine
- molecular weight:
- 161.2
- Synonym(s):
- γ-trimethyl-hydroxybutyrobetaine
- 3-hydroxy-4-trimethylammoniobutanoate
- R-(-)-3-hydroxy-4-trimethylaminobutyrate
- vitamin B T
- bicarnesine
- (R)-carnitine
- γ-L-trimethyl-β-hydroxybutyrobetaine
- vitamin Bt
- 3-carboxy-2-hydroxy-N,N,N-trimethyl-1-propanaminium
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 44985-71-9
- CAS : 541-15-1
- METABOLIGHTS : MTBLC16347
- DRUGBANK : DB00583
- PUBCHEM:
- HMDB : HMDB14721
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : crn
"C(C(O)CC(=O)[O-])[N+](C)(C)C" cannot be used as a page name in this wiki.