Difference between revisions of "RXN-17754"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CARBON-DIOXIDE TransportSeed_CARBON-DIOXIDE] == * direction: ** LEFT-TO-RIGHT * Synon...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CARBON-DIOXIDE TransportSeed_CARBON-DIOXIDE] ==
* smiles:
+
* direction:
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
+
* common name:
+
** (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
+
* molecular weight:
+
** 519.151   
+
 
* Synonym(s):
 
* Synonym(s):
** 3',8-cH2GTP
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-8340]]
+
** 1.0 [[CARBON-DIOXIDE]][e] '''=>''' 1.0 [[CARBON-DIOXIDE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 CO2[e] '''=>''' 1.0 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[manual]]:
 +
** [[added to manage seeds from extracellular to cytosol compartment]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=(8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}}
+
{{#set: reconstruction category=manual}}
{{#set: molecular weight=519.151    }}
+
{{#set: reconstruction source=added to manage seeds from extracellular to cytosol compartment}}
{{#set: common name=3',8-cH2GTP}}
+
{{#set: produced by=RXN-8340}}
+

Revision as of 18:08, 10 January 2018

Reaction TransportSeed_CARBON-DIOXIDE

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

Reconstruction information

External links