Difference between revisions of "Tiso gene 13748"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-234-Saturated-acyl-CoAs Long-Chain-234-Saturated-acyl-CoAs] == * common name: ** a l...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-414 CPD-414] == * smiles: ** CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O * inchi key...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-234-Saturated-acyl-CoAs Long-Chain-234-Saturated-acyl-CoAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-414 CPD-414] ==
 +
* smiles:
 +
** CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O
 +
* inchi key:
 +
** InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M
 
* common name:
 
* common name:
** a long-chain 2,3,4-saturated fatty acyl CoA
+
** N-acetyl-4-O-acetylneuraminate
 +
* molecular weight:
 +
** 350.302   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13181]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[LONG-CHAIN-ACYL-COA-DEHYDROGENASE-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a long-chain 2,3,4-saturated fatty acyl CoA}}
+
* PUBCHEM:
{{#set: consumed or produced by=LONG-CHAIN-ACYL-COA-DEHYDROGENASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244557 25244557]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29006 29006]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C04015 C04015]
 +
* HMDB : HMDB00796
 +
{{#set: smiles=CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O}}
 +
{{#set: inchi key=InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M}}
 +
{{#set: common name=N-acetyl-4-O-acetylneuraminate}}
 +
{{#set: molecular weight=350.302    }}
 +
{{#set: consumed by=RXN-13181}}

Revision as of 18:08, 10 January 2018

Metabolite CPD-414

  • smiles:
    • CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O
  • inchi key:
    • InChIKey=LVBIMVQYUKOENY-FODKYPIKSA-M
  • common name:
    • N-acetyl-4-O-acetylneuraminate
  • molecular weight:
    • 350.302
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O" cannot be used as a page name in this wiki.