Difference between revisions of "Tiso gene 10778"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
 
(Created page with "Category:Gene == Gene Tiso_gene_7966 == * left end position: ** 203 * transcription direction: ** NEGATIVE * right end position: ** 10515 * centisome position: ** 1.905208...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] ==
+
== Gene Tiso_gene_7966 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))
+
** 203
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** triiodothyroacetate ether glucuronide
+
** 10515
−
* molecular weight:
+
* centisome position:
−
** 796.046    
+
** 1.9052088    
 
* Synonym(s):
 
* Synonym(s):
−
** triiodothyroacetic acid ether glucuronide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
−
* [[RXN-10619]]
+
** experimental_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-1224]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-15117]]
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways associated ==
 +
* [[PWY-7817]]
 +
* [[PWY-6773]]
 +
* [[PWYQT-4427]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=203}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659025 90659025]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))}}
+
{{#set: right end position=10515}}
−
{{#set: inchi key=InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L}}
+
{{#set: centisome position=1.9052088   }}
−
{{#set: common name=triiodothyroacetate ether glucuronide}}
+
{{#set: reaction associated=13-BETA-GLUCAN-SYNTHASE-RXN|RXN-1224|RXN-15117}}
−
{{#set: molecular weight=796.046   }}
+
{{#set: pathway associated=PWY-7817|PWY-6773|PWYQT-4427}}
−
{{#set: common name=triiodothyroacetic acid ether glucuronide}}
+
−
{{#set: produced by=RXN-10619}}
+

Revision as of 17:09, 10 January 2018

Gene Tiso_gene_7966

  • left end position:
    • 203
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 10515
  • centisome position:
    • 1.9052088
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10778&oldid=16423"