Difference between revisions of "CPD-11529"

Revision as of 18:09, 10 January 2018

"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tau-proteins Tau-proteins] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
+* smiles:
+** C(C(=O)[O-])C(O)[CH]=O
+* inchi key:
+** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
 * common name:
-** a tau protein
+** L-malic semialdehyde
+* molecular weight:
+** 117.081
 * Synonym(s):
+** (3R)-3-hydroxy-4-oxobutanoate
 == Reaction(s) known to consume the compound ==
+* [[RXN-6002]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
-* [[TAU-PROTEIN-KINASE-RXN]]
 == External links  ==
-{{#set: common name=a tau protein}}
+* PUBCHEM:
-{{#set: consumed or produced by=TAU-PROTEIN-KINASE-RXN}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
+{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
+{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
+{{#set: common name=L-malic semialdehyde}}
+{{#set: molecular weight=117.081    }}
+{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
+{{#set: consumed by=RXN-6002}}