Difference between revisions of "Tiso gene 1107"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9157 RXN-9157] == * direction: ** LEFT-TO-RIGHT * common name: ** gamma-glutamyl_transferase *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11529 CPD-11529] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9157 RXN-9157] ==
−
* smiles:
+
* direction:
−
** CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J
+
 
* common name:
 
* common name:
−
** jasmonoyl-CoA
+
** gamma-glutamyl_transferase
−
* molecular weight:
+
* ec number:
−
** 955.76   
+
** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10708]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[GLUTATHIONE]][c] '''+''' 1 [[CPD-9699]][c] '''=>''' 1 [[CPD-9700]][c] '''+''' 1 [[CYS-GLY]][c]
−
* [[RXN-10701]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 glutathione[c] '''+''' 1 hypoglycin A[c] '''=>''' 1 hypoglycin B[c] '''+''' 1 L-cysteinyl-glycine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_12321]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5826]], hypoglycin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5826 PWY-5826]
 +
** '''4''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237154 44237154]
+
{{#set: common name=gamma-glutamyl_transferase}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: ec number=EC-2.3.2.2}}
−
{{#set: inchi key=InChIKey=WQKKCPPNDKSAIU-PCDAEQFSSA-J}}
+
{{#set: gene associated=Tiso_gene_12321}}
−
{{#set: common name=jasmonoyl-CoA}}
+
{{#set: in pathway=PWY-5826}}
−
{{#set: molecular weight=955.76    }}
+
{{#set: reconstruction category=orthology}}
−
{{#set: consumed by=RXN-10708}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: produced by=RXN-10701}}
+
{{#set: reconstruction source=esiliculosus}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction source=in-silico_annotation}}

Revision as of 18:09, 10 January 2018

Reaction RXN-9157

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • gamma-glutamyl_transferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 glutathione[c] + 1 hypoglycin A[c] => 1 hypoglycin B[c] + 1 L-cysteinyl-glycine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5826, hypoglycin biosynthesis: PWY-5826
    • 4 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1107&oldid=16433"