Difference between revisions of "Peptides-with-Leader-Sequence"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LNLCCOAL LNLCCOAL] == * direction: ** LEFT-TO-RIGHT * common name: ** Linoleic acid:CoA ligase (AMP...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] == * smiles: ** CCC(C([O-])=O)C(C(=O)[O-])=O * inchi key: ** InChIKey=OUGL...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=LNLCCOAL LNLCCOAL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19492 CPD-19492] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC(C([O-])=O)C(C(=O)[O-])=O
 +
* inchi key:
 +
** InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L
 
* common name:
 
* common name:
−
** Linoleic acid:CoA ligase (AMP-forming)
+
** 3-ethyl-2-oxosuccinate
 +
* molecular weight:
 +
** 158.11   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-18211]]
−
** 1.0 [[CO-A]][c] '''+''' 1.0 [[LINOLEIC_ACID]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[PPI]][c] '''+''' 1.0 [[AMP]][c] '''+''' 1.0 [[CPD-18]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 coenzyme A[c] '''+''' 1.0 linoleate[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 diphosphate[c] '''+''' 1.0 AMP[c] '''+''' 1.0 linoleoyl-CoA[c]
+
* [[RXN-18210]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_12275]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_9394]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCC(C([O-])=O)C(C(=O)[O-])=O}}
−
{{#set: common name=Linoleic acid:CoA ligase (AMP-forming)}}
+
{{#set: inchi key=InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L}}
−
{{#set: gene associated=Tiso_gene_12275|Tiso_gene_9394}}
+
{{#set: common name=3-ethyl-2-oxosuccinate}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=158.11    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN-18211}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed or produced by=RXN-18210}}
−
{{#set: reconstruction source=creinhardtii}}
+

Revision as of 18:11, 10 January 2018

Metabolite CPD-19492

  • smiles:
    • CCC(C([O-])=O)C(C(=O)[O-])=O
  • inchi key:
    • InChIKey=OUGLPIHDPBRSID-UHFFFAOYSA-L
  • common name:
    • 3-ethyl-2-oxosuccinate
  • molecular weight:
    • 158.11
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(C([O-])=O)C(C(=O)[O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Peptides-with-Leader-Sequence&oldid=16550"