Difference between revisions of "RXN-14286"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-tRNAfmet L-methionyl-tRNAfmet] == * common name: ** an L-methionyl-[initiator tRNAm...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] == * smiles: ** C([O-])(=O)C([N+])CC1(C=CC=CC=1) * inchi key: ** InChIKey=COLNVLDHVKWL...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHE PHE] == |
+ | * smiles: | ||
+ | ** C([O-])(=O)C([N+])CC1(C=CC=CC=1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=COLNVLDHVKWLRT-QMMMGPOBSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-phenylalanine |
+ | * molecular weight: | ||
+ | ** 165.191 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2S-α-phenylalanine |
+ | ** F | ||
+ | ** endophenyl | ||
+ | ** phenylalanine | ||
+ | ** phe | ||
+ | ** L-phe | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RME144]] |
+ | * [[PHENYLALANINE--TRNA-LIGASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-10814]] | ||
+ | * [[PHEAMINOTRANS-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 63-91-2 |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC58095 |
− | {{#set: consumed by= | + | * PUBCHEM: |
− | {{#set: produced by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6925665 6925665] |
+ | * HMDB : HMDB00159 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00079 C00079] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58095 58095] | ||
+ | * BIGG : phe__L | ||
+ | {{#set: smiles=C([O-])(=O)C([N+])CC1(C=CC=CC=1)}} | ||
+ | {{#set: inchi key=InChIKey=COLNVLDHVKWLRT-QMMMGPOBSA-N}} | ||
+ | {{#set: common name=L-phenylalanine}} | ||
+ | {{#set: molecular weight=165.191 }} | ||
+ | {{#set: common name=2S-α-phenylalanine|F|endophenyl|phenylalanine|phe|L-phe}} | ||
+ | {{#set: consumed by=RME144|PHENYLALANINE--TRNA-LIGASE-RXN}} | ||
+ | {{#set: consumed or produced by=RXN-10814|PHEAMINOTRANS-RXN}} |
Revision as of 18:12, 10 January 2018
Contents
Metabolite PHE
- smiles:
- C([O-])(=O)C([N+])CC1(C=CC=CC=1)
- inchi key:
- InChIKey=COLNVLDHVKWLRT-QMMMGPOBSA-N
- common name:
- L-phenylalanine
- molecular weight:
- 165.191
- Synonym(s):
- 2S-α-phenylalanine
- F
- endophenyl
- phenylalanine
- phe
- L-phe
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 63-91-2
- METABOLIGHTS : MTBLC58095
- PUBCHEM:
- HMDB : HMDB00159
- LIGAND-CPD:
- CHEBI:
- BIGG : phe__L
"C([O-])(=O)C([N+])CC1(C=CC=CC=1)" cannot be used as a page name in this wiki.