Difference between revisions of "Tiso gene 6898"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18533 == * left end position: ** 56 * transcription direction: ** POSITIVE * right end position: ** 530 * centisome position: ** 1.891253...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLMETHIONINE N-FORMYLMETHIONINE] == * smiles: ** CSCCC(N[CH]=O)C(=O)[O-] * inchi key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLMETHIONINE N-FORMYLMETHIONINE] == |
− | * | + | * smiles: |
− | ** | + | ** CSCCC(N[CH]=O)C(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PYUSHNKNPOHWEZ-YFKPBYRVSA-M |
− | * | + | * common name: |
− | ** | + | ** N-formyl-L-methionine |
− | * | + | * molecular weight: |
− | ** | + | ** 176.21 |
* Synonym(s): | * Synonym(s): | ||
+ | ** fMet | ||
+ | ** N-formyl-methionine | ||
+ | ** formylmethionine | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[FORMYLMETHIONINE-DEFORMYLASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 4289-98-9 |
− | {{#set: | + | * DRUGBANK : DB04464 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288223 5288223] |
− | {{#set: | + | * HMDB : HMDB01015 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03145 C03145] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57809 57809] | ||
+ | {{#set: smiles=CSCCC(N[CH]=O)C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=PYUSHNKNPOHWEZ-YFKPBYRVSA-M}} | ||
+ | {{#set: common name=N-formyl-L-methionine}} | ||
+ | {{#set: molecular weight=176.21 }} | ||
+ | {{#set: common name=fMet|N-formyl-methionine|formylmethionine}} | ||
+ | {{#set: consumed by=FORMYLMETHIONINE-DEFORMYLASE-RXN}} |
Revision as of 17:13, 10 January 2018
Contents
Metabolite N-FORMYLMETHIONINE
- smiles:
- CSCCC(N[CH]=O)C(=O)[O-]
- inchi key:
- InChIKey=PYUSHNKNPOHWEZ-YFKPBYRVSA-M
- common name:
- N-formyl-L-methionine
- molecular weight:
- 176.21
- Synonym(s):
- fMet
- N-formyl-methionine
- formylmethionine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 4289-98-9
- DRUGBANK : DB04464
- PUBCHEM:
- HMDB : HMDB01015
- LIGAND-CPD:
- CHEBI:
"CSCCC(N[CH]=O)C(=O)[O-" cannot be used as a page name in this wiki.