Difference between revisions of "Tiso gene 507"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCHOMOSERLYASE-RXN O-SUCCHOMOSERLYASE-RXN] == * direction: ** REVERSIBLE * ec number: ** [http:...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == * smiles: ** CS(=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=QEFRNWWLZK...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCHOMOSERLYASE-RXN O-SUCCHOMOSERLYASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CS(=O)CCC([N+])C(=O)[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.5.1.48 EC-2.5.1.48]
+
** InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
 +
* common name:
 +
** L-methionine-(R)-S-oxide
 +
* molecular weight:
 +
** 165.207   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-methionine-R-sulfoxide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[1.8.4.14-RXN]]
−
** 1 [[O-SUCCINYL-L-HOMOSERINE]][c] '''+''' 1 [[CYS]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[L-CYSTATHIONINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 O-succinyl-L-homoserine[c] '''+''' 1 L-cysteine[c] '''<=>''' 1 H+[c] '''+''' 1 succinate[c] '''+''' 1 L-cystathionine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3732]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
* [[PWY-I9]], L-cysteine biosynthesis VI (from L-methionine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-I9 PWY-I9]
+
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
−
* [[HOMOSER-METSYN-PWY]], L-methionine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
−
*** [[esiliculosus]]
+
−
*** [[athaliana]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20397 20397]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11862103 11862103]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03260 R03260]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58773 58773]
−
* UNIPROT:
+
* BIGG : metsox_R__L
−
** [http://www.uniprot.org/uniprot/P0A4K2 P0A4K2]
+
{{#set: smiles=CS(=O)CCC([N+])C(=O)[O-]}}
−
** [http://www.uniprot.org/uniprot/Q9CEC6 Q9CEC6]
+
{{#set: inchi key=InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N}}
−
** [http://www.uniprot.org/uniprot/P38675 P38675]
+
{{#set: common name=L-methionine-(R)-S-oxide}}
−
** [http://www.uniprot.org/uniprot/P24601 P24601]
+
{{#set: molecular weight=165.207    }}
−
** [http://www.uniprot.org/uniprot/P00935 P00935]
+
{{#set: common name=L-methionine-R-sulfoxide}}
−
** [http://www.uniprot.org/uniprot/O04981 O04981]
+
{{#set: consumed by=1.8.4.14-RXN}}
−
** [http://www.uniprot.org/uniprot/O04982 O04982]
+
−
** [http://www.uniprot.org/uniprot/O81334 O81334]
+
−
** [http://www.uniprot.org/uniprot/Q79VD9 Q79VD9]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: ec number=EC-2.5.1.48}}
+
−
{{#set: gene associated=Tiso_gene_3732}}
+
−
{{#set: in pathway=PWY-I9|HOMOSER-METSYN-PWY}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=creinhardtii|esiliculosus|athaliana}}
+

Revision as of 18:13, 10 January 2018

Metabolite CPD-8990

  • smiles:
    • CS(=O)CCC([N+])C(=O)[O-]
  • inchi key:
    • InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
  • common name:
    • L-methionine-(R)-S-oxide
  • molecular weight:
    • 165.207
  • Synonym(s):
    • L-methionine-R-sulfoxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CS(=O)CCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_507&oldid=16765"